1,1,2,2-Tetramethyl-1,2-diphenyldisilane, 97%
cas: 1145-98-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,1,2,2-Tetramethyl-1,2-diphenyldisilane, 97% (CAS 1145-98-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 25g, 100mg, 250mg, 1g, 100g. Oferty producentów: Ambeed, Chemat.
| producent | Ambeed |
|---|---|
| nr katalogowy | A446320-5g |
| cas | 1145-98-8 |
| opakowanie | 5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 5g | 387,06 Pln | |
| Ambeed | 25g | 1338,25 Pln | |
| Chemat | 100mg | 83,60 Pln | |
| Chemat | 250mg | 98,00 Pln | |
| Chemat | 1g | 131,60 Pln | |
| Chemat | 5g | 318,80 Pln | |
| Chemat | 25g | 1326,80 Pln | |
| Chemat | 100g | 3448,40 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 1-2 tygodnie |
[dimethyl(phenyl)silyl]-dimethyl-phenylsilane (CAS 1145-98-8) to związek chemiczny o wzorze sumarycznym C16H22Si2 i masie molowej 270.52 g/mol. Nazwa systematyczna IUPAC: [dimethyl(phenyl)silyl]-dimethyl-phenylsilane. InChIKey: IIOOIYHUTINYQO-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H22Si2 |
|---|---|
| Masa molowa | 270.52 g/mol |
| Nazwa IUPAC | [dimethyl(phenyl)silyl]-dimethyl-phenylsilane |
| InChIKey | IIOOIYHUTINYQO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C1=CC=CC=C1)[Si](C)(C)C2=CC=CC=C2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1,1,2,2-Tetramethyl-1,2-diphenyldisilane, 1,2-Diphenyltetramethyldisilane, [dimethyl(phenyl)silyl]-dimethyl-phenylsilane, Disilane, 1,1,2,2-tetramethyl-1,2-diphenyl-, 1,2-Diphenyl-1,1,2,2-tetramethyldisilane, Bisphenyl-1,1,2,2-tetramethyldisilane, Disilane,1,1,2,2-tetramethyl-1,2-diphenyl-, Tetramethyldiphenyldisilan, tetramethyldiphenyldisilane, Tetramethyl-1,2-diphenyldisilane