cas: 6316-70-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,2,3-Trimethoxy-5-(2-nitroethenyl)benzene, 97% (CAS 6316-70-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11EACE-100mg |
| cas | 6316-70-7 |
| opakowanie | 100mg |
| dostępność | 15g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 266,00 Pln | |
| Chemat | 250mg | 400,40 Pln | |
| Chemat | 1g | 976,40 Pln | |
| Chemat | 5g | 3165,20 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
1,2,3-trimethoxy-5-[(E)-2-nitroethenyl]benzene (CAS 6316-70-7) to związek chemiczny o wzorze sumarycznym C11H13NO5 i masie molowej 239.22 g/mol. Nazwa systematyczna IUPAC: 1,2,3-trimethoxy-5-[(E)-2-nitroethenyl]benzene. InChIKey: PEPYBEJQAIGLRE-SNAWJCMRSA-N.
| Wzór sumaryczny | C11H13NO5 |
|---|---|
| Masa molowa | 239.22 g/mol |
| Nazwa IUPAC | 1,2,3-trimethoxy-5-[(E)-2-nitroethenyl]benzene |
| InChIKey | PEPYBEJQAIGLRE-SNAWJCMRSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=C/[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)