1,2-Bis(3,4-dimethylphenyl)ethane, ≥95%
cas: 34101-86-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,2-Bis(3,4-dimethylphenyl)ethane, ≥95% (CAS 34101-86-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 200mg, 250mg, 1g, 5g. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114DC6-200mg |
| cas | 34101-86-5 |
| opakowanie | 200mg |
| dostępność | 25g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 200mg | 184,40 Pln | |
| Chemat | 250mg | 208,40 Pln | |
| Chemat | 1g | 381,20 Pln | |
| Chemat | 5g | 1514,00 Pln | |
| Fluorochem | 250mg | 362,39 Pln | |
| Fluorochem | 1g | 695,61 Pln | |
| Fluorochem | 5g | 2809,45 Pln |
właściwości
| czystość | ≥95% |
|---|---|
| czas dostawy | 3 tygodnie |
4-[2-(3,4-dimethylphenyl)ethyl]-1,2-dimethylbenzene (CAS 34101-86-5) to związek chemiczny o wzorze sumarycznym C18H22 i masie molowej 238.4 g/mol. Nazwa systematyczna IUPAC: 4-[2-(3,4-dimethylphenyl)ethyl]-1,2-dimethylbenzene. InChIKey: MOPBWASVAUDDTC-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H22 |
|---|---|
| Masa molowa | 238.4 g/mol |
| Nazwa IUPAC | 4-[2-(3,4-dimethylphenyl)ethyl]-1,2-dimethylbenzene |
| InChIKey | MOPBWASVAUDDTC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CCC2=CC(=C(C=C2)C)C)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Benzene, 1,1'-(1,2-ethanediyl)bis[3,4-dimethyl-, Benzene, 1,1'-(1,2-ethanediyl)bis(3,4-dimethyl-, 1,2-Bis(3,4-dimethylphenyl)ethane, 4-[2-(3,4-dimethylphenyl)ethyl]-1,2-dimethylbenzene, 1,2-Di(3,4-xylyl)ethane, 1,2-bis-(3,4-Dimethylphenyl)ethane, MOPBWASVAUDDTC-UHFFFAOYSA-N, 1,1'-(Ethane-1,2-diyl)bis(3,4-dimethylbenzene), 4-[2-(3,4-dimethylphenyl)ethyl]-1,2-dimethyl-benzene