1,2-Bis(4-fluorophenyl)-2-hydroxyethanone, 98%
cas: 53458-16-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,2-Bis(4-fluorophenyl)-2-hydroxyethanone, 98% (CAS 53458-16-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 100mg, 5g. Oferty producentów: Ambeed, Chemat, BLDpharm, Fluorochem.
| producent | Ambeed |
|---|---|
| nr katalogowy | A121029-250mg |
| cas | 53458-16-5 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 515,00 Pln | |
| Ambeed | 1g | 1015,62 Pln | |
| Chemat | 100mg | 131,60 Pln | |
| Chemat | 250mg | 213,20 Pln | |
| Chemat | 1g | 434,00 Pln | |
| Chemat | 5g | 1610,00 Pln | |
| BLDpharm | 100mg | 430,98 Pln | |
| BLDpharm | 250mg | 547,61 Pln | |
| BLDpharm | 1g | 1091,86 Pln | |
| Fluorochem | 250mg | 362,39 Pln | |
| Fluorochem | 1g | 914,28 Pln | |
| Fluorochem | 5g | 2882,34 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
1,2-bis(4-fluorophenyl)-2-hydroxyethanone (CAS 53458-16-5) to związek chemiczny o wzorze sumarycznym C14H10F2O2 i masie molowej 248.22 g/mol. Nazwa systematyczna IUPAC: 1,2-bis(4-fluorophenyl)-2-hydroxyethanone. InChIKey: VGZHWXAFILGMSR-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H10F2O2 |
|---|---|
| Masa molowa | 248.22 g/mol |
| Nazwa IUPAC | 1,2-bis(4-fluorophenyl)-2-hydroxyethanone |
| InChIKey | VGZHWXAFILGMSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)C2=CC=C(C=C2)F)O)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1,2-bis(4-fluorophenyl)-2-hydroxyethanone, 4,4'-difluorobenzoin, 1,2-Bis(4-fluorophenyl)-2-hydroxyethan-1-one, 2-hydroxy-1,2-bis(4-fluorophenyl)ethanone, 12-Bis(4-fluorophenyl)-2-hydroxyethanone, 1,2 Bis(4-fluorophenyl)-2-hydroxy ethanone, 1,2-bis(4-fluorophenyl)-2-hydroxy-ethanone, 4,4 inverted exclamation mark -Difluorobenzoin, 1,2-bis-(4-fluorophenyl)-2-hydroxyethan-1-one