1,2-Bis(4-nitrophenyl)ethane-1,2-dione, 95%
cas: 6067-45-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,2-Bis(4-nitrophenyl)ethane-1,2-dione, 95% (CAS 6067-45-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A213410-100mg |
| cas | 6067-45-4 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 1199,19 Pln | |
| Ambeed | 250mg | 2117,00 Pln | |
| Chemat | 100mg | 726,80 Pln | |
| Chemat | 250mg | 1173,20 Pln | |
| BLDpharm | 100mg | 1286,24 Pln | |
| BLDpharm | 250mg | 2280,33 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
1,2-bis(4-nitrophenyl)ethane-1,2-dione (CAS 6067-45-4) to związek chemiczny o wzorze sumarycznym C14H8N2O6 i masie molowej 300.22 g/mol. Nazwa systematyczna IUPAC: 1,2-bis(4-nitrophenyl)ethane-1,2-dione. InChIKey: YRKNWVLBLGRGRK-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H8N2O6 |
|---|---|
| Masa molowa | 300.22 g/mol |
| Nazwa IUPAC | 1,2-bis(4-nitrophenyl)ethane-1,2-dione |
| InChIKey | YRKNWVLBLGRGRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1,2-bis(4-nitrophenyl)ethane-1,2-dione, 4,4'-dinitrobenzil, 1,2-bis(4-nitrophenyl)-1,2-ethanedione, Ethanedione, bis(4-nitrophenyl)-, 1,2-bis{4-nitrophenyl}-1,2-ethanedione, Bis(4-nitrophenyl) diketone, 1,2-Bis-(4-nitro-phenyl)-ethane-1,2-dione, 1,2-Dione-Based Compound, 5, YRKNWVLBLGRGRK-UHFFFAOYSA-N, 1,2-Ethanedione, 1,2-bis(4-nitrophenyl)-