1,2-Bis(4-vinylphenyl)ethane, 98%
cas: 48174-52-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,2-Bis(4-vinylphenyl)ethane, 98% (CAS 48174-52-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 100mg. Oferty producentów: Ambeed, Chemat, BLDpharm, Fluorochem.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1487279-250mg |
| cas | 48174-52-3 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 209,06 Pln | |
| Ambeed | 1g | 409,31 Pln | |
| Ambeed | 5g | 1249,25 Pln | |
| Ambeed | 10g | 1961,25 Pln | |
| Chemat | 100mg | 102,80 Pln | |
| Chemat | 250mg | 126,80 Pln | |
| Chemat | 1g | 237,20 Pln | |
| Chemat | 5g | 928,40 Pln | |
| Chemat | 10g | 1451,60 Pln | |
| BLDpharm | 100mg | 142,20 Pln | |
| BLDpharm | 250mg | 192,18 Pln | |
| BLDpharm | 1g | 403,22 Pln | |
| BLDpharm | 5g | 1230,70 Pln | |
| BLDpharm | 10g | 1924,90 Pln | |
| Fluorochem | 5g | 1185,02 Pln | |
| Fluorochem | 1g | 393,63 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
1-ethenyl-4-[2-(4-ethenylphenyl)ethyl]benzene (CAS 48174-52-3) to związek chemiczny o wzorze sumarycznym C18H18 i masie molowej 234.3 g/mol. Nazwa systematyczna IUPAC: 1-ethenyl-4-[2-(4-ethenylphenyl)ethyl]benzene. InChIKey: ZXLAFQNTMMFLSA-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H18 |
|---|---|
| Masa molowa | 234.3 g/mol |
| Nazwa IUPAC | 1-ethenyl-4-[2-(4-ethenylphenyl)ethyl]benzene |
| InChIKey | ZXLAFQNTMMFLSA-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)CCC2=CC=C(C=C2)C=C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Benzene, 1,1'-(1,2-ethanediyl)bis[4-ethenyl-, Benzene, 1,1'-(1,2-ethanediyl)bis(4-ethenyl-, 1,2-Bis(4-vinylphenyl)ethane, p,p'-Divinyl-1,2-diphenylethane, 1-ethenyl-4-[2-(4-ethenylphenyl)ethyl]benzene, 1,2-bis(p-vinylphenyl)ethane, Bibenzyl, 4,4-divinyl-, p,p'-Divinyl-1,2-diphenylethane(BVPE), 1-vinyl-4-[2-(4-vinylphenyl)ethyl]benzene, 1,1'-(Ethane-1,2-diyl)bis(4-ethenylbenzene)