1,2-Bis(perbromophenyl)ethane, 98%, 98%
cas: 84852-53-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,2-Bis(perbromophenyl)ethane, 98%, 98% (CAS 84852-53-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50g, 250g, 1kg, 5kg, 10kg, 25g, 100g, 500g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114DBZ-50g |
| cas | 84852-53-9 |
| opakowanie | 50g |
| dostępność | 20000g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50g | 83,60 Pln | |
| Chemat | 250g | 122,00 Pln | |
| Chemat | 1kg | 352,40 Pln | |
| Chemat | 5kg | 1761,60 Pln | |
| Chemat | 10kg | cena na żądanie | |
| Chemat | 25g | 74,00 Pln | |
| Chemat | 100g | 88,40 Pln | |
| Chemat | 500g | 240,00 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
1,2,3,4,5-pentabromo-6-[2-(2,3,4,5,6-pentabromophenyl)ethyl]benzene (CAS 84852-53-9) to związek chemiczny o wzorze sumarycznym C14H4Br10 i masie molowej 971.2 g/mol. Nazwa systematyczna IUPAC: 1,2,3,4,5-pentabromo-6-[2-(2,3,4,5,6-pentabromophenyl)ethyl]benzene. InChIKey: BZQKBFHEWDPQHD-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H4Br10 |
|---|---|
| Masa molowa | 971.2 g/mol |
| Nazwa IUPAC | 1,2,3,4,5-pentabromo-6-[2-(2,3,4,5,6-pentabromophenyl)ethyl]benzene |
| InChIKey | BZQKBFHEWDPQHD-UHFFFAOYSA-N |
| SMILES | C(CC1=C(C(=C(C(=C1Br)Br)Br)Br)Br)C2=C(C(=C(C(=C2Br)Br)Br)Br)Br |
Dane obliczone przez PubChem (NCBI)
Synonimy:
DECABROMODIPHENYLETHANE, decabromodiphenyl ethane, DeBDethane, 1,2-bis(pentabromophenyl)ethane, Benzene, 1,1'-(1,2-ethanediyl)bis[2,3,4,5,6-pentabromo-, Benzene, 1,1'-(1,2-ethanediyl)bis(2,3,4,5,6-pentabromo-, ethane, 1,2-bis(pentabromophenyl), 1,2-Bis(perbromophenyl)ethane, 1,2-Bis(2,3,4,5,6-pentabromophenyl)ethane, 1,2,3,4,5-pentabromo-6-[2-(2,3,4,5,6-pentabromophenyl)ethyl]benzene