cas: 73790-20-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,2-Bis[4-(trifluoromethyl)phenyl]-1,2-ethanedione, 97%, 97% (CAS 73790-20-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch116KNF-100mg |
| cas | 73790-20-2 |
| opakowanie | 100mg |
| dostępność | 10g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 131,60 Pln | |
| Chemat | 250mg | 165,20 Pln | |
| Chemat | 1g | 270,80 Pln | |
| Chemat | 5g | 890,00 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-dione (CAS 73790-20-2) to związek chemiczny o wzorze sumarycznym C16H8F6O2 i masie molowej 346.22 g/mol. Nazwa systematyczna IUPAC: 1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-dione. InChIKey: WHTKSZOXPDAVMH-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H8F6O2 |
|---|---|
| Masa molowa | 346.22 g/mol |
| Nazwa IUPAC | 1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-dione |
| InChIKey | WHTKSZOXPDAVMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=CC=C(C=C2)C(F)(F)F)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)