1,2-Di(thiophen-2-yl)ethane-1,2-dione, 98%, 98%
cas: 7333-07-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,2-Di(thiophen-2-yl)ethane-1,2-dione, 98%, 98% (CAS 7333-07-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114FCM-100mg |
| cas | 7333-07-5 |
| opakowanie | 100mg |
| dostępność | 10g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 150,80 Pln | |
| Chemat | 250mg | 160,40 Pln | |
| Chemat | 1g | 304,40 Pln | |
| Chemat | 5g | 419,60 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
1,2-dithiophen-2-ylethane-1,2-dione (CAS 7333-07-5) to związek chemiczny o wzorze sumarycznym C10H6O2S2 i masie molowej 222.3 g/mol. Nazwa systematyczna IUPAC: 1,2-dithiophen-2-ylethane-1,2-dione. InChIKey: UNWKVSDABPCZMK-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H6O2S2 |
|---|---|
| Masa molowa | 222.3 g/mol |
| Nazwa IUPAC | 1,2-dithiophen-2-ylethane-1,2-dione |
| InChIKey | UNWKVSDABPCZMK-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)C(=O)C2=CC=CS2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2,2'-Thenil, 1,2-di(thiophen-2-yl)ethane-1,2-dione, 1,2-dithiophen-2-ylethane-1,2-dione, bis(thiophen-2-yl)ethane-1,2-dione, 1,2-di(2-thienyl)-1,2-ethanedione, 1,2-Di-thiophen-2-yl-ethane-1,2-dione, 1,2-di(2-thienyl)ethane-1,2-dione, 2,2 inverted exclamation marka-Thenil, Ethanedione, di-2-thienyl-, Di-2-thienylethanedione