1,2-Diphenyl-1,2-bis(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethene, 95%, 95%
cas: 2095541-89-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,2-Diphenyl-1,2-bis(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethene, 95%, 95% (CAS 2095541-89-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12XBKT-100mg |
| cas | 2095541-89-0 |
| opakowanie | 100mg |
| dostępność | 20g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 131,60 Pln | |
| Chemat | 250mg | 170,00 Pln | |
| Chemat | 1g | 266,00 Pln | |
| Chemat | 5g | 846,80 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
2-[4-[(E)-1,2-diphenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2095541-89-0) to związek chemiczny o wzorze sumarycznym C38H42B2O4 i masie molowej 584.4 g/mol. Nazwa systematyczna IUPAC: 2-[4-[(E)-1,2-diphenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CBYRLHIEJOHEIW-JEIPZWNWSA-N.
| Wzór sumaryczny | C38H42B2O4 |
|---|---|
| Masa molowa | 584.4 g/mol |
| Nazwa IUPAC | 2-[4-[(E)-1,2-diphenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CBYRLHIEJOHEIW-JEIPZWNWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)/C(=C(\C3=CC=CC=C3)/C4=CC=C(C=C4)B5OC(C(O5)(C)C)(C)C)/C6=CC=CC=C6 |
Dane obliczone przez PubChem (NCBI)