cas: 325142-82-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)phenyl]-, 98%, 98% (CAS 325142-82-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch118FMK-250mg |
| cas | 325142-82-3 |
| opakowanie | 250mg |
| dostępność | 200g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 69,20 Pln | |
| Chemat | 1g | 74,00 Pln | |
| Chemat | 5g | 93,20 Pln | |
| Chemat | 10g | 122,00 Pln | |
| Chemat | 25g | 213,20 Pln | |
| Chemat | 100g | 674,00 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (CAS 325142-82-3) to związek chemiczny o wzorze sumarycznym C13H16BF3O2 i masie molowej 272.07 g/mol. Nazwa systematyczna IUPAC: 4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: GJNOCGLTCQPYAC-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H16BF3O2 |
|---|---|
| Masa molowa | 272.07 g/mol |
| Nazwa IUPAC | 4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | GJNOCGLTCQPYAC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)