cas: 1813554-40-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-, 95%, 95% (CAS 1813554-40-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12FFYD-250mg |
| cas | 1813554-40-3 |
| opakowanie | 250mg |
| dostępność | 10g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 424,40 Pln | |
| Chemat | 1g | 832,40 Pln | |
| Chemat | 5g | 2627,60 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane (CAS 1813554-40-3) to związek chemiczny o wzorze sumarycznym C20H22BF3O3 i masie molowej 378.2 g/mol. Nazwa systematyczna IUPAC: 4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane. InChIKey: WWHKUPQIPGDPFH-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H22BF3O3 |
|---|---|
| Masa molowa | 378.2 g/mol |
| Nazwa IUPAC | 4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane |
| InChIKey | WWHKUPQIPGDPFH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC3=CC=C(C=C3)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)