1,3,5,7-Tetraphenyladamantane, 95%
cas: 16004-75-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,3,5,7-Tetraphenyladamantane, 95% (CAS 16004-75-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 25g. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112RMF-100mg |
| cas | 16004-75-4 |
| opakowanie | 100mg |
| dostępność | 175g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 88,40 Pln | |
| Chemat | 250mg | 98,00 Pln | |
| Chemat | 1g | 160,40 Pln | |
| Chemat | 5g | 429,20 Pln | |
| Chemat | 25g | 1384,40 Pln | |
| Fluorochem | 5g | 664,37 Pln | |
| Fluorochem | 25g | 2366,89 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
1,3,5,7-tetraphenyladamantane (CAS 16004-75-4) to związek chemiczny o wzorze sumarycznym C34H32 i masie molowej 440.6 g/mol. Nazwa systematyczna IUPAC: 1,3,5,7-tetraphenyladamantane. InChIKey: YDUVZTACEKAXTE-UHFFFAOYSA-N.
| Wzór sumaryczny | C34H32 |
|---|---|
| Masa molowa | 440.6 g/mol |
| Nazwa IUPAC | 1,3,5,7-tetraphenyladamantane |
| InChIKey | YDUVZTACEKAXTE-UHFFFAOYSA-N |
| SMILES | C1C2(CC3(CC1(CC(C2)(C3)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6)C7=CC=CC=C7 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1,3,5,7-tetraphenyladamantane, Tricyclo[3.3.1.13,7]decane, 1,3,5,7-tetraphenyl-, 1,3,5,7-tetraphenyltricyclo[3.3.1.13,7]decane, 1,3,5,7-Tetraphenyladamantan, 1,3,5,7-tetraphenyladamantane,95%, 1,3,5,7-Tetraphenyladamantane - [T94283], 1.3.5.7-Tetraphenyl-adamantan; Tricyclo[3.3.1.13,7]decane,1,3,5,7-tetraphenyl