1,3-Diethenyl-1,3-dimethyl-1,3-diphenyldisiloxane, 98%
cas: 2627-97-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,3-Diethenyl-1,3-dimethyl-1,3-diphenyldisiloxane, 98% (CAS 2627-97-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch113SJA-1g |
| cas | 2627-97-6 |
| opakowanie | 1g |
| dostępność | 50g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 93,20 Pln | |
| Chemat | 5g | 155,60 Pln | |
| Chemat | 10g | 227,60 Pln | |
| Chemat | 25g | 419,60 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Ethenyl-(ethenyl-methyl-phenylsilyl)oxy-methyl-phenylsilane (CAS 2627-97-6) to związek chemiczny o wzorze sumarycznym C18H22OSi2 i masie molowej 310.5 g/mol. Nazwa systematyczna IUPAC: ethenyl-(ethenyl-methyl-phenylsilyl)oxy-methyl-phenylsilane. InChIKey: KPWVUBSQUODFPP-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H22OSi2 |
|---|---|
| Masa molowa | 310.5 g/mol |
| Nazwa IUPAC | ethenyl-(ethenyl-methyl-phenylsilyl)oxy-methyl-phenylsilane |
| InChIKey | KPWVUBSQUODFPP-UHFFFAOYSA-N |
| SMILES | C[Si](C=C)(C1=CC=CC=C1)O[Si](C)(C=C)C2=CC=CC=C2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1,3-Dimethyl-1,3-diphenyl-1,3-divinyldisiloxane, Disiloxane, 1,3-diethenyl-1,3-dimethyl-1,3-diphenyl-, Disiloxane, 1,3-dimethyl-1,3-diphenyl-1,3-divinyl-, ethenyl-(ethenyl-methyl-phenylsilyl)oxy-methyl-phenylsilane, ethenyl({[ethenyl(methyl)phenylsilyl]oxy})methyl(phenyl)silane, 1,3-Diethenyl-1,3-dimethyl-1,3-diphenyldisiloxane, 1,3-diethenyl-1,3-dimethyl-1,3-diphenyl-disiloxan, C18H22OSi2, 1,3-Dimethyl-1,3-diphenyl, KPWVUBSQUODFPP-UHFFFAOYSA-N