1,4-Benzenediacrylic acid, 97%
cas: 16323-43-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,4-Benzenediacrylic acid, 97% (CAS 16323-43-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 50g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112TXR-1g |
| cas | 16323-43-6 |
| opakowanie | 1g |
| dostępność | 155g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 83,60 Pln | |
| Chemat | 5g | 136,40 Pln | |
| Chemat | 10g | 198,80 Pln | |
| Chemat | 25g | 371,60 Pln | |
| Chemat | 50g | 650,00 Pln | |
| Chemat | 100g | 1130,00 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
(E)-3-[4-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid (CAS 16323-43-6) to związek chemiczny o wzorze sumarycznym C12H10O4 i masie molowej 218.20 g/mol. Nazwa systematyczna IUPAC: (E)-3-[4-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid. InChIKey: AAFXQFIGKBLKMC-KQQUZDAGSA-N.
| Wzór sumaryczny | C12H10O4 |
|---|---|
| Masa molowa | 218.20 g/mol |
| Nazwa IUPAC | (E)-3-[4-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid |
| InChIKey | AAFXQFIGKBLKMC-KQQUZDAGSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)/C=C/C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1,4-Phenylenediacrylic acid, p-Benzenediacrylic acid, 2-Propenoic acid, 3,3'-(1,4-phenylene)bis-, (E,E)-, 3,3'-(1,4-Phenylene)bis-2-propenoic acid, Phenylene)bis-2-propenoic acid, 3,3'-(1,4-, 2-Propenoic acid, 3,3'-(1,4-phenylene)bis-, (2E,2'E)-, 1,4-Benzenediacrylic acid, p-Phenylenediacrylic acid, 2-Propenoic acid, 3,3'-(1,4-phenylene)bis-, (2E,2'E)-3,3'-(1,4-Phenylene)bis[2-propenoic acid]