1,4-Butylenebis(diphenylphosphine)palladium dichloride, 97%
cas: 29964-62-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,4-Butylenebis(diphenylphosphine)palladium dichloride, 97% (CAS 29964-62-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A327496-250mg |
| cas | 29964-62-3 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 153,44 Pln | |
| Ambeed | 1g | 259,12 Pln | |
| Ambeed | 5g | 726,38 Pln | |
| Ambeed | 10g | 1227,00 Pln | |
| Ambeed | 25g | 2962,50 Pln | |
| Chemat | 250mg | 88,40 Pln | |
| Chemat | 1g | 165,20 Pln | |
| Chemat | 5g | 515,60 Pln | |
| BLDpharm | 250mg | 142,20 Pln | |
| BLDpharm | 1g | 275,48 Pln | |
| BLDpharm | 5g | 775,31 Pln | |
| BLDpharm | 10g | 1319,56 Pln | |
| BLDpharm | 25g | 3191,12 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 1-2 tygodnie |
Dichloropalladium;4-diphenylphosphanylbutyl(diphenyl)phosphane (CAS 29964-62-3) to związek chemiczny o wzorze sumarycznym C28H28Cl2P2Pd i masie molowej 603.8 g/mol. Nazwa systematyczna IUPAC: dichloropalladium;4-diphenylphosphanylbutyl(diphenyl)phosphane. InChIKey: JQXJBXVWVPVTOO-UHFFFAOYSA-L.
| Wzór sumaryczny | C28H28Cl2P2Pd |
|---|---|
| Masa molowa | 603.8 g/mol |
| Nazwa IUPAC | dichloropalladium;4-diphenylphosphanylbutyl(diphenyl)phosphane |
| InChIKey | JQXJBXVWVPVTOO-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)P(CCCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl[Pd]Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(Butane-1,4-diyl)bis(diphenylphosphane)--dichloropalladium (1/1), 1,4-Bis(diphenylphosphino)butane-palladium(II) chloride, 1,4-Butylenebis(diphenylphosphine)palladium dichloride, [1,4-Bis(diphenylphosphino)butane]palladium(II) Dichloride, Dichloro[1,4-bis(diphenylphosphino)butane]palladium(II), dichloropalladium;4-diphenylphosphanylbutyl(diphenyl)phosphane, PdCl2(dppb), Dichloro-1,4-bis(diphenylphosphino)butane-palladium(II), Pd(dppb)Cl2, dichloropalladium,4-diphenylphosphanylbutyl(diphenyl)phosphane