1,7-Dimethyl-1H-Purine-2,6(3H,7H)-Dione, 98%, 98%
cas: 611-59-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,7-Dimethyl-1H-Purine-2,6(3H,7H)-Dione, 98%, 98% (CAS 611-59-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114TK1-100mg |
| cas | 611-59-6 |
| opakowanie | 100mg |
| dostępność | 20g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 146,00 Pln | |
| Chemat | 250mg | 198,80 Pln | |
| Chemat | 1g | 270,80 Pln | |
| Chemat | 5g | 611,60 Pln | |
| Chemat | 10g | 890,00 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
1,7-dimethyl-3H-purine-2,6-dione (CAS 611-59-6) to związek chemiczny o wzorze sumarycznym C7H8N4O2 i masie molowej 180.16 g/mol. Nazwa systematyczna IUPAC: 1,7-dimethyl-3H-purine-2,6-dione. InChIKey: QUNWUDVFRNGTCO-UHFFFAOYSA-N.
| Wzór sumaryczny | C7H8N4O2 |
|---|---|
| Masa molowa | 180.16 g/mol |
| Nazwa IUPAC | 1,7-dimethyl-3H-purine-2,6-dione |
| InChIKey | QUNWUDVFRNGTCO-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=O)N(C(=O)N2)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
paraxanthine, 1,7-Dimethylxanthine, p-Xanthine, 1,7-dimethyl-3H-purine-2,6-dione, 1H-Purine-2,6-dione, 3,7-dihydro-1,7-dimethyl-, 1,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione, 1,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione, 1,7-Dimethyl-1H-purine-2,6(3H,7H)-dione, 3,7-Dihydro-1,7-dimethyl-1H-purine-2,6-dione, Xanthine, 1,7-dimethyl-