1-(3,4-Difluorophenyl)-2,2,2-trifluoroethanone, 95+%
cas: 302912-28-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1-(3,4-Difluorophenyl)-2,2,2-trifluoroethanone, 95+% (CAS 302912-28-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A901363-100mg |
| cas | 302912-28-3 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 320,31 Pln | |
| Ambeed | 250mg | 487,19 Pln | |
| Ambeed | 1g | 1221,44 Pln | |
| Ambeed | 5g | 3168,31 Pln | |
| BLDpharm | 100mg | 336,57 Pln | |
| BLDpharm | 250mg | 519,84 Pln | |
| BLDpharm | 1g | 1314,01 Pln | |
| BLDpharm | 5g | 3407,71 Pln |
właściwości
| czystość | 95+% |
|---|---|
| czas dostawy | 2-3 tygodnie |
1-(3,4-difluorophenyl)-2,2,2-trifluoroethanone (CAS 302912-28-3) to związek chemiczny o wzorze sumarycznym C8H3F5O i masie molowej 210.10 g/mol. Nazwa systematyczna IUPAC: 1-(3,4-difluorophenyl)-2,2,2-trifluoroethanone. InChIKey: WEKSIOBQIQXAEE-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H3F5O |
|---|---|
| Masa molowa | 210.10 g/mol |
| Nazwa IUPAC | 1-(3,4-difluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | WEKSIOBQIQXAEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(F)(F)F)F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2,2,2,3',4'-Pentafluoroacetophenone, 1-(3,4-difluorophenyl)-2,2,2-trifluoroethanone, 1-(3,4-difluorophenyl)-2,2,2-trifluoroethan-1-one, 1-(3,4-difluorophenyl)-2,2,2-trifluoro-ethanone, 2,2,2,3',4'-Pentafluoroacetophenone, 95%, 1-(3,4-difluoro-phenyl)-2,2,2-trifluoro-ethanone, InChI=1/C8H3F5O/c9-5-2-1-4(3-6(5)10)7(14)8(11,12)13/h1-3
