cas: 851477-20-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1-(3,5-Bis(trifluoromethyl)phenyl)-3-((1S,2S)-2-(dimethylamino)cyclohexyl)thiourea, 98%, 98% (CAS 851477-20-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1140PD-100mg |
| cas | 851477-20-8 |
| opakowanie | 100mg |
| dostępność | 125g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 78,80 Pln | |
| Chemat | 250mg | 83,60 Pln | |
| Chemat | 1g | 126,80 Pln | |
| Chemat | 5g | 314,00 Pln | |
| Chemat | 10g | 530,00 Pln | |
| Chemat | 25g | 1178,00 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S,2S)-2-(dimethylamino)cyclohexyl]thiourea (CAS 851477-20-8) to związek chemiczny o wzorze sumarycznym C17H21F6N3S i masie molowej 413.4 g/mol. Nazwa systematyczna IUPAC: 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S,2S)-2-(dimethylamino)cyclohexyl]thiourea. InChIKey: NQRCAVZHOLYEBJ-KBPBESRZSA-N.
| Wzór sumaryczny | C17H21F6N3S |
|---|---|
| Masa molowa | 413.4 g/mol |
| Nazwa IUPAC | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S,2S)-2-(dimethylamino)cyclohexyl]thiourea |
| InChIKey | NQRCAVZHOLYEBJ-KBPBESRZSA-N |
| SMILES | CN(C)[C@H]1CCCC[C@@H]1NC(=S)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)