cas: 1807685-51-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1-(3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethan-1-one, 95%, 95% (CAS 1807685-51-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11I10M-100mg |
| cas | 1807685-51-3 |
| opakowanie | 100mg |
| dostępność | 20g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 242,00 Pln | |
| Chemat | 250mg | 371,60 Pln | |
| Chemat | 1g | 914,00 Pln | |
| Chemat | 5g | 2387,60 Pln | |
| Chemat | 10g | 4710,80 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (CAS 1807685-51-3) to związek chemiczny o wzorze sumarycznym C14H18BFO3 i masie molowej 264.10 g/mol. Nazwa systematyczna IUPAC: 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone. InChIKey: QRPSPYZFNHVURF-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H18BFO3 |
|---|---|
| Masa molowa | 264.10 g/mol |
| Nazwa IUPAC | 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| InChIKey | QRPSPYZFNHVURF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)C)F |
Dane obliczone przez PubChem (NCBI)