1-(4-(Trifluoromethoxy)phenyl)-1H-pyrrole-2,5-dione, 95%
cas: 68255-58-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1-(4-(Trifluoromethoxy)phenyl)-1H-pyrrole-2,5-dione, 95% (CAS 68255-58-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A144627-250mg |
| cas | 68255-58-3 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 253,56 Pln | |
| Ambeed | 1g | 731,94 Pln | |
| Ambeed | 5g | 2345,06 Pln | |
| Chemat | 100mg | 222,80 Pln | |
| Chemat | 250mg | 328,40 Pln | |
| Chemat | 1g | 784,40 Pln | |
| Chemat | 5g | 2589,20 Pln | |
| BLDpharm | 250mg | 269,93 Pln | |
| BLDpharm | 1g | 780,86 Pln | |
| BLDpharm | 5g | 2524,69 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione (CAS 68255-58-3) to związek chemiczny o wzorze sumarycznym C11H6F3NO3 i masie molowej 257.16 g/mol. Nazwa systematyczna IUPAC: 1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione. InChIKey: QNYNUXQOTWCDOQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H6F3NO3 |
|---|---|
| Masa molowa | 257.16 g/mol |
| Nazwa IUPAC | 1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
| InChIKey | QNYNUXQOTWCDOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)OC(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1-[4-(trifluoromethoxy)phenyl]-1H-pyrrole-2,5-dione, 1-(4-(trifluoromethoxy)phenyl)-1H-pyrrole-2,5-dione, 1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione, 1H-pyrrole-2,5-dione, 1-[4-(trifluoromethoxy)phenyl]-, 1-[4-(trifluoromethoxy)phenyl]-2,5-dihydro-1H-pyrrole-2,5-dione, N-[4-(Trifluoromethoxy)phenyl]maleimide, 1-[4-(trifluoromethoxy)phenyl]azoline-2,5-dione, Cyto9F9, 1-(4-Trifluoromethoxy-phenyl)-pyrrole-2,5-dione, 1-4-(Trifluoromethoxy)phenyl-1H-pyrrole-2,5-dione