cas: 97760-76-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1-(4-Amino-3-chloro-5-(trifluoromethyl)phenyl)ethanone, 97%, 97% (CAS 97760-76-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 1g, 5g, 10g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11IJZA-50mg |
| cas | 97760-76-4 |
| opakowanie | 50mg |
| dostępność | 20g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 107,60 Pln | |
| Chemat | 100mg | 112,40 Pln | |
| Chemat | 250mg | 141,20 Pln | |
| Chemat | 1g | 251,60 Pln | |
| Chemat | 5g | 813,20 Pln | |
| Chemat | 10g | 1494,80 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]ethanone (CAS 97760-76-4) to związek chemiczny o wzorze sumarycznym C9H7ClF3NO i masie molowej 237.60 g/mol. Nazwa systematyczna IUPAC: 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]ethanone. InChIKey: GVPVKKWXJXESIC-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H7ClF3NO |
|---|---|
| Masa molowa | 237.60 g/mol |
| Nazwa IUPAC | 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]ethanone |
| InChIKey | GVPVKKWXJXESIC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)Cl)N)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)