1-(4-Fluorophenyl)-1H-pyrrole-2,5-dione, 98%
cas: 6633-22-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1-(4-Fluorophenyl)-1H-pyrrole-2,5-dione, 98% (CAS 6633-22-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 50mg. Oferty producentów: Ambeed, BLDpharm, Chemat.
| producent | Ambeed |
|---|---|
| nr katalogowy | A295897-250mg |
| cas | 6633-22-3 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 309,19 Pln | |
| Ambeed | 1g | 542,81 Pln | |
| Ambeed | 5g | 1427,25 Pln | |
| BLDpharm | 250mg | 325,47 Pln | |
| BLDpharm | 1g | 575,38 Pln | |
| BLDpharm | 5g | 1536,15 Pln | |
| Chemat | 50mg | 93,20 Pln | |
| Chemat | 250mg | 218,00 Pln | |
| Chemat | 1g | 453,20 Pln | |
| Chemat | 5g | 1173,20 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
1-(4-fluorophenyl)pyrrole-2,5-dione (CAS 6633-22-3) to związek chemiczny o wzorze sumarycznym C10H6FNO2 i masie molowej 191.16 g/mol. Nazwa systematyczna IUPAC: 1-(4-fluorophenyl)pyrrole-2,5-dione. InChIKey: SBKKXWSZVVDOLR-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H6FNO2 |
|---|---|
| Masa molowa | 191.16 g/mol |
| Nazwa IUPAC | 1-(4-fluorophenyl)pyrrole-2,5-dione |
| InChIKey | SBKKXWSZVVDOLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
n-(4-fluoro-phenyl)maleimide, 1-(4-Fluorophenyl)-1H-pyrrole-2,5-dione, 1-(4-Fluoro-phenyl)-pyrrole-2,5-dione, N-(4-fluorophenyl)maleimide, 1-(4-fluorophenyl)pyrrole-2,5-dione, 1-(4-fluorophenyl)-2,5-dihydro-1H-pyrrole-2,5-dione, 1H-Pyrrole-2,5-dione, 1-(4-fluorophenyl)-, 1-(4-fluorophenyl)-pyrrole-2,5-dione, 1-(4-fluorophenyl)azoline-2,5-dione, N-p-Fluorophenylmaleimide
