1-[4-(Methylsulfanyl)phenyl]-1,4-pentanedione, 97%
cas: 189501-33-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1-[4-(Methylsulfanyl)phenyl]-1,4-pentanedione, 97% (CAS 189501-33-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g, 5g, 10g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11AOWO-100mg |
| cas | 189501-33-5 |
| opakowanie | 100mg |
| dostępność | 10g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 467,60 Pln | |
| Chemat | 250mg | 597,20 Pln | |
| Chemat | 500mg | 957,20 Pln | |
| Chemat | 1g | 1408,40 Pln | |
| Chemat | 5g | 4091,60 Pln | |
| Chemat | 10g | 6822,80 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
1-(4-methylsulfanylphenyl)pentane-1,4-dione (CAS 189501-33-5) to związek chemiczny o wzorze sumarycznym C12H14O2S i masie molowej 222.31 g/mol. Nazwa systematyczna IUPAC: 1-(4-methylsulfanylphenyl)pentane-1,4-dione. InChIKey: HSJZPSYCLXIRPN-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H14O2S |
|---|---|
| Masa molowa | 222.31 g/mol |
| Nazwa IUPAC | 1-(4-methylsulfanylphenyl)pentane-1,4-dione |
| InChIKey | HSJZPSYCLXIRPN-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC(=O)C1=CC=C(C=C1)SC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1-[4-(methylsulfanyl)phenyl]-1,4-pentanedione, 1-(4-(Methylsulfanyl)phenyl)-1,4-pentanedione, 1-(4-methylsulfanylphenyl)pentane-1,4-dione, 1-[4-(methylsulfanyl)phenyl]pentane-1,4-dione, 1-(4-(Methylthio)phenyl)pentane-1,4-dione, 1-[4-(Methylthio)phenyl]-1,4-pentanedione, 1-[4-(Methylthio)phenyl]pentane-1,4-dione, 1,4-Pentanedione, 1-[4-(methylthio)phenyl]-, 1-(4-methylthiophenyl)pentane-1,4-dione