1-Chloroethyl (4-nitrophenyl) carbonate, 97%
cas: 101623-69-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1-Chloroethyl (4-nitrophenyl) carbonate, 97% (CAS 101623-69-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A163644-250mg |
| cas | 101623-69-2 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 125,62 Pln | |
| Ambeed | 1g | 131,19 Pln | |
| Ambeed | 5g | 147,88 Pln | |
| Ambeed | 10g | 192,38 Pln | |
| Ambeed | 25g | 253,56 Pln | |
| Ambeed | 100g | 659,62 Pln | |
| Ambeed | 500g | 2128,12 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 1-2 tygodnie |
1-chloroethyl (4-nitrophenyl) carbonate (CAS 101623-69-2) to związek chemiczny o wzorze sumarycznym C9H8ClNO5 i masie molowej 245.61 g/mol. Nazwa systematyczna IUPAC: 1-chloroethyl (4-nitrophenyl) carbonate. InChIKey: DXVQFTPXVZUWIF-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H8ClNO5 |
|---|---|
| Masa molowa | 245.61 g/mol |
| Nazwa IUPAC | 1-chloroethyl (4-nitrophenyl) carbonate |
| InChIKey | DXVQFTPXVZUWIF-UHFFFAOYSA-N |
| SMILES | CC(OC(=O)OC1=CC=C(C=C1)[N+](=O)[O-])Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1-chloroethyl (4-nitrophenyl) Carbonate, 1-chloroethyl 4-nitrophenyl carbonate, Carbonic acid, 1-chloroethyl 4-nitrophenyl ester, Carbonic acid 4-nitro-phenyl ester 1-chloro-ethyl ester, 1-Chloroethyl p-Nitrophenyl Carbonate, DXVQFTPXVZUWIF-UHFFFAOYSA-N, 1-Chloroethyl 4-nitrophenyl carbonat, 1-chloroethyl(4-nitrophenyl)Carbonate, alpha-chloroethyl 4-nitrophenyl carbonate, alpha-chloroethyl para-nitrophenyl Carbonate