1-tert-Butyl 2-methyl 1H-indole-1,2-dicarboxylate, 95%
cas: 163229-48-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1-tert-Butyl 2-methyl 1H-indole-1,2-dicarboxylate, 95% (CAS 163229-48-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A813655-250mg |
| cas | 163229-48-9 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 348,12 Pln | |
| Ambeed | 1g | 804,25 Pln | |
| Ambeed | 5g | 2117,00 Pln | |
| BLDpharm | 250mg | 369,89 Pln | |
| BLDpharm | 1g | 864,16 Pln | |
| BLDpharm | 5g | 2280,33 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
1-O-tert-butyl 2-O-methyl indole-1,2-dicarboxylate (CAS 163229-48-9) to związek chemiczny o wzorze sumarycznym C15H17NO4 i masie molowej 275.30 g/mol. Nazwa systematyczna IUPAC: 1-O-tert-butyl 2-O-methyl indole-1,2-dicarboxylate. InChIKey: UJVYYFYNECMKRA-UHFFFAOYSA-N.
| Wzór sumaryczny | C15H17NO4 |
|---|---|
| Masa molowa | 275.30 g/mol |
| Nazwa IUPAC | 1-O-tert-butyl 2-O-methyl indole-1,2-dicarboxylate |
| InChIKey | UJVYYFYNECMKRA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC=CC=C2C=C1C(=O)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1-tert-Butyl 2-methyl 1H-indole-1,2-dicarboxylate, 1-(tert-Butyl) 2-methyl 1H-indole-1,2-dicarboxylate, 1-O-tert-butyl 2-O-methyl indole-1,2-dicarboxylate, tert-butyl methyl 1h-indole-1,2-dicarboxylate, 1H-Indole-1,2-dicarboxylic acid, 1-(1,1-dimethylethyl) 2-methyl ester, Methyl 1-boc-1H-indole-2-carboxylate, 1-(1,1-Dimethylethyl) 2-methyl 1H-indole-1,2-dicarboxylate, Methyl 1H-indole-2-carboxylate, N-BOC protected, 1-tert-Butyl2-methyl1H-indole-1,2-dicarboxylate, O1-tert-butyl O2-methyl indole-1,2-dicarboxylate
