10-Methyl-10H-phenothiazine 5-oxide, 95%
cas: 2234-09-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
10-Methyl-10H-phenothiazine 5-oxide, 95% (CAS 2234-09-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 50mg, 100mg. Oferty producentów: Ambeed, Chemat.
| producent | Ambeed |
|---|---|
| nr katalogowy | A478394-250mg |
| cas | 2234-09-5 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 1043,44 Pln | |
| Ambeed | 1g | 2617,62 Pln | |
| Chemat | 50mg | 304,40 Pln | |
| Chemat | 100mg | 467,60 Pln | |
| Chemat | 250mg | 798,80 Pln | |
| Chemat | 1g | 1974,80 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
10-methylphenothiazine 5-oxide (CAS 2234-09-5) to związek chemiczny o wzorze sumarycznym C13H11NOS i masie molowej 229.30 g/mol. Nazwa systematyczna IUPAC: 10-methylphenothiazine 5-oxide. InChIKey: LUXDKIVXVUWRQB-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H11NOS |
|---|---|
| Masa molowa | 229.30 g/mol |
| Nazwa IUPAC | 10-methylphenothiazine 5-oxide |
| InChIKey | LUXDKIVXVUWRQB-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2S(=O)C3=CC=CC=C31 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
10H-Phenothiazine, 10-methyl-, 5-oxide, 10-Methyl-10H-phenothiazine 5-oxide, 10-Methylphenothiazine 5-oxide, N-Methylphenothiazine S-oxide, Methylphenothiazine Sulfoxide, Phenothiazine, 10-methyl-, 5-oxide, 10-Methyl-10H-phenothiazine-5-oxide, 10-methyl-10H-5??-phenothiazin-5-one, LUXDKIVXVUWRQB-UHFFFAOYSA-N, 10-Methyl-10H-phenothiazine5-oxide