14H-Anthra[2,1,9-mna]thioxanthen-14-one, 95%
cas: 16294-75-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
14H-Anthra[2,1,9-mna]thioxanthen-14-one, 95% (CAS 16294-75-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 10g, 25g, 100g, 500g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A223578-250mg |
| cas | 16294-75-0 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 125,62 Pln | |
| Ambeed | 1g | 131,19 Pln | |
| Ambeed | 10g | 147,88 Pln | |
| Ambeed | 25g | 164,56 Pln | |
| Ambeed | 100g | 325,88 Pln | |
| Ambeed | 500g | 1210,31 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
8-thiahexacyclo[10.10.2.02,7.09,23.013,18.020,24]tetracosa-1(23),2,4,6,9,11,13,15,17,20(24),21-undecaen-19-one (CAS 16294-75-0) to związek chemiczny o wzorze sumarycznym C23H12OS i masie molowej 336.4 g/mol. Nazwa systematyczna IUPAC: 8-thiahexacyclo[10.10.2.02,7.09,23.013,18.020,24]tetracosa-1(23),2,4,6,9,11,13,15,17,20(24),21-undecaen-19-one. InChIKey: NVNWZZLOQBHTCW-UHFFFAOYSA-N.
| Wzór sumaryczny | C23H12OS |
|---|---|
| Masa molowa | 336.4 g/mol |
| Nazwa IUPAC | 8-thiahexacyclo[10.10.2.02,7.09,23.013,18.020,24]tetracosa-1(23),2,4,6,9,11,13,15,17,20(24),21-undecaen-19-one |
| InChIKey | NVNWZZLOQBHTCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=C4C5=C(C=CC(=C35)C2=O)C6=CC=CC=C6S4 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
14h-anthra[2,1,9-mna]thioxanthen-14-one, Solvent Orange 63, 14H-Anthra(2,1,9-mna)thioxanthen-14-one, 14H-Anthra[219-mna]thioxanthen-14-one, Fluorescent Red GG, H-Anthra(2,1,9-mna)thioxanthen--on, Fluorescent Tangerine GG, C.I.Solvent Orange 63, NVNWZZLOQBHTCW-UHFFFAOYSA-N, anthra[2,1,9-mna]thioxanthen-14-one