2'-Fluoro -2'-deoxyguanosine, 98%
cas: 78842-13-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2'-Fluoro -2'-deoxyguanosine, 98% (CAS 78842-13-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch116D99-100mg |
| cas | 78842-13-4 |
| opakowanie | 100mg |
| dostępność | 200g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 122,00 Pln | |
| Chemat | 250mg | 131,60 Pln | |
| Chemat | 1g | 198,80 Pln | |
| Chemat | 5g | 477,20 Pln | |
| Chemat | 10g | 683,60 Pln | |
| Chemat | 25g | 1096,40 Pln | |
| Chemat | 50g | 1715,60 Pln | |
| Chemat | 100g | 2541,20 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
2-amino-9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 78842-13-4) to związek chemiczny o wzorze sumarycznym C10H12FN5O4 i masie molowej 285.23 g/mol. Nazwa systematyczna IUPAC: 2-amino-9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: UXUZARPLRQRNNX-DXTOWSMRSA-N.
| Wzór sumaryczny | C10H12FN5O4 |
|---|---|
| Masa molowa | 285.23 g/mol |
| Nazwa IUPAC | 2-amino-9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | UXUZARPLRQRNNX-DXTOWSMRSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)F)N=C(NC2=O)N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2'-Deoxy-2'-fluoroguanosine, 2'-Dfgs, Guanosine, 2'-deoxy-2'-fluoro-, 2'-Fluoro-2'-deoxyguanosine, 2'-Fluoro -2'-deoxyguanosine, 2 inverted exclamation marka-Deoxy-2 inverted exclamation marka-fluoroguanosine, 2-Fluoro -2-deoxyguanosine, 9-(2-deoxy-2-fluoro-beta-D-ribofuranosyl)guanine, 2'-Fluoro-2'-deoxy-D-guanosine, deoxyfluoroguanosine