2,2':5',2'':5'',2'''-Quaterthiophene, 97%
cas: 5632-29-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,2':5',2'':5'',2'''-Quaterthiophene, 97% (CAS 5632-29-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 500mg, 5g. Oferty producentów: Fluorochem, Chemat.
| producent | Fluorochem |
|---|---|
| nr katalogowy | F866051-100MG |
| cas | 5632-29-1 |
| opakowanie | 100mg |
| dostępność | In Stock China |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Fluorochem | 100mg | 294,71 Pln | |
| Fluorochem | 250mg | 476,93 Pln | |
| Fluorochem | 1g | 1164,19 Pln | |
| Chemat | 100mg | 237,20 Pln | |
| Chemat | 250mg | 362,00 Pln | |
| Chemat | 500mg | 664,40 Pln | |
| Chemat | 1g | 842,00 Pln | |
| Chemat | 5g | 3635,60 Pln |
właściwości
| czystość | 97% |
|---|---|
| podwójne zastosowanie | No |
| waluta | EUR |
| czas dostawy | 2-3 tygodnie |
| kategoria | Odczynniki chemiczne |
2-thiophen-2-yl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene (CAS 5632-29-1) to związek chemiczny o wzorze sumarycznym C16H10S4 i masie molowej 330.5 g/mol. Nazwa systematyczna IUPAC: 2-thiophen-2-yl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene. InChIKey: FXEJOIFDICYSSO-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H10S4 |
|---|---|
| Masa molowa | 330.5 g/mol |
| Nazwa IUPAC | 2-thiophen-2-yl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene |
| InChIKey | FXEJOIFDICYSSO-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(S2)C3=CC=C(S3)C4=CC=CS4 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
alpha-Quarterthiophene, alpha-Quaterthienyl, alpha-Quaterthiophene, 2-thiophen-2-yl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene, 2-(2-thienyl)-5-[5-(2-thienyl)-2-thienyl]thiophene, 2-(thiophen-2-yl)-5-[5-(thiophen-2-yl)thiophen-2-yl]thiophene, |A-Quaterthiophene, ubql09, I<<-Quaterthiophene, I+/--Quaterthienyl