2,2'-(((9H-Thioxanthene-9,9-diyl)bis(4,1-phenylene))bis(oxy))diethanol, 95%
cas: 2845127-35-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,2'-(((9H-Thioxanthene-9,9-diyl)bis(4,1-phenylene))bis(oxy))diethanol, 95% (CAS 2845127-35-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1516173-250mg |
| cas | 2845127-35-5 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 1182,50 Pln | |
| Ambeed | 1g | 3023,69 Pln | |
| Ambeed | 5g | 8931,06 Pln | |
| Chemat | 100mg | 640,40 Pln | |
| Chemat | 250mg | 1043,60 Pln | |
| Chemat | 1g | 2723,60 Pln | |
| Chemat | 5g | 9366,80 Pln | |
| BLDpharm | 100mg | 714,22 Pln | |
| BLDpharm | 250mg | 1152,95 Pln | |
| BLDpharm | 1g | 2996,75 Pln | |
| BLDpharm | 5g | 9627,75 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
2-[4-[9-[4-(2-hydroxyethoxy)phenyl]thioxanthen-9-yl]phenoxy]ethanol (CAS 2845127-35-5) to związek chemiczny o wzorze sumarycznym C29H26O4S i masie molowej 470.6 g/mol. Nazwa systematyczna IUPAC: 2-[4-[9-[4-(2-hydroxyethoxy)phenyl]thioxanthen-9-yl]phenoxy]ethanol. InChIKey: HXBXXHFXTCIOKX-UHFFFAOYSA-N.
| Wzór sumaryczny | C29H26O4S |
|---|---|
| Masa molowa | 470.6 g/mol |
| Nazwa IUPAC | 2-[4-[9-[4-(2-hydroxyethoxy)phenyl]thioxanthen-9-yl]phenoxy]ethanol |
| InChIKey | HXBXXHFXTCIOKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C3S2)(C4=CC=C(C=C4)OCCO)C5=CC=C(C=C5)OCCO |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2,2'-(((9H-Thioxanthene-9,9-diyl)bis(4,1-phenylene))bis(oxy))diethanol, 2-(4-{9-[4-(2-hydroxyethoxy)phenyl]-9H-thioxanthen-9-yl}phenoxy)ethan-1-ol, 2-[4-[9-[4-(2-hydroxyethoxy)phenyl]thioxanthen-9-yl]phenoxy]ethanol, 2,2'-(((9H-thioxanthene-9,9-diyl)bis(4,1-phenylene))bis(oxy))bis(ethan-1-ol)