2,2'-(1,2-Phenylene)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane], 98%
cas: 269410-07-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,2'-(1,2-Phenylene)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane], 98% (CAS 269410-07-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 250g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114A21-100mg |
| cas | 269410-07-3 |
| opakowanie | 100mg |
| dostępność | 500g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 74,00 Pln | |
| Chemat | 250mg | 88,40 Pln | |
| Chemat | 1g | 122,00 Pln | |
| Chemat | 5g | 304,40 Pln | |
| Chemat | 10g | 501,20 Pln | |
| Chemat | 25g | 1096,40 Pln | |
| Chemat | 50g | 2061,20 Pln | |
| Chemat | 250g | 5219,60 Pln | |
| Chemat | 500g | 8985,60 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
4,4,5,5-tetramethyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane (CAS 269410-07-3) to związek chemiczny o wzorze sumarycznym C18H28B2O4 i masie molowej 330.0 g/mol. Nazwa systematyczna IUPAC: 4,4,5,5-tetramethyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane. InChIKey: VCTMQXIOUDZIGS-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H28B2O4 |
|---|---|
| Masa molowa | 330.0 g/mol |
| Nazwa IUPAC | 4,4,5,5-tetramethyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | VCTMQXIOUDZIGS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2B3OC(C(O3)(C)C)(C)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2,2'-(1,2-Phenylene)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane], 2,2'-(1,2-Phenylene)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane), 1,2-Benzenediboronic Acid Bis(pinacol) Ester, 1,2-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene, 2,2-(1,2-Phenylene)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane], 1,2-Phenylenediboronic Acid Bis(pinacol) Ester, 1,2-bis(4,4,5,5-tetramethyl-[1,3,2]dioxabororan-2-yl)benzene, 1,2-Bis(4,4,, 1,2-Phenylenebis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane), 2,2a(2)-(1,2-Phenylene)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane]