cas: 1004294-77-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,2,2-Trifluoro-1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethanone, 97%, 97% (CAS 1004294-77-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119UR4-100mg |
| cas | 1004294-77-2 |
| opakowanie | 100mg |
| dostępność | 20g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 194,00 Pln | |
| Chemat | 250mg | 280,40 Pln | |
| Chemat | 1g | 616,40 Pln | |
| Chemat | 5g | 1850,00 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (CAS 1004294-77-2) to związek chemiczny o wzorze sumarycznym C14H16BF3O3 i masie molowej 300.08 g/mol. Nazwa systematyczna IUPAC: 2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone. InChIKey: PDKVUFXTFXPSGZ-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H16BF3O3 |
|---|---|
| Masa molowa | 300.08 g/mol |
| Nazwa IUPAC | 2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| InChIKey | PDKVUFXTFXPSGZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)