cas: 2352666-14-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,2,2-Trifluoro-1-(4-vinylphenyl)ethanol, 95%, 95% (CAS 2352666-14-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch13AK5C-50mg |
| cas | 2352666-14-7 |
| opakowanie | 50mg |
| dostępność | 1.75g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 477,20 Pln | |
| Chemat | 100mg | 765,20 Pln | |
| Chemat | 250mg | 1259,60 Pln | |
| Chemat | 1g | 3290,00 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
1-(4-ethenylphenyl)-2,2,2-trifluoroethanol (CAS 2352666-14-7) to związek chemiczny o wzorze sumarycznym C10H9F3O i masie molowej 202.17 g/mol. Nazwa systematyczna IUPAC: 1-(4-ethenylphenyl)-2,2,2-trifluoroethanol. InChIKey: PQQVFITXQHCGGH-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H9F3O |
|---|---|
| Masa molowa | 202.17 g/mol |
| Nazwa IUPAC | 1-(4-ethenylphenyl)-2,2,2-trifluoroethanol |
| InChIKey | PQQVFITXQHCGGH-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C(C(F)(F)F)O |
Dane obliczone przez PubChem (NCBI)