2,4,6-Trifluorophenylboronic Acid, 98%, 98%
cas: 182482-25-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,4,6-Trifluorophenylboronic Acid, 98%, 98% (CAS 182482-25-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 500g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1134WW-1g |
| cas | 182482-25-3 |
| opakowanie | 1g |
| dostępność | 1500g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 78,80 Pln | |
| Chemat | 5g | 122,00 Pln | |
| Chemat | 10g | 179,60 Pln | |
| Chemat | 25g | 352,40 Pln | |
| Chemat | 500g | 5078,40 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2,4,6-trifluorophenyl)boronic acid (CAS 182482-25-3) to związek chemiczny o wzorze sumarycznym C6H4BF3O2 i masie molowej 175.90 g/mol. Nazwa systematyczna IUPAC: (2,4,6-trifluorophenyl)boronic acid. InChIKey: IPEIGKHHSZFAEW-UHFFFAOYSA-N.
| Wzór sumaryczny | C6H4BF3O2 |
|---|---|
| Masa molowa | 175.90 g/mol |
| Nazwa IUPAC | (2,4,6-trifluorophenyl)boronic acid |
| InChIKey | IPEIGKHHSZFAEW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)F)F)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2,4,6-Trifluorophenylboronic acid, (2,4,6-trifluorophenyl)boronic Acid, o,o,p-trifluorophenylboronic acid, 2,4,6-Trifluorobenzeneboronic Acid, Boronic acid, B-(2,4,6-trifluorophenyl)-, 2,4,6-Trifluorophenylboronicacid, Boronic acid, (2,4,6-trifluorophenyl)-, 2,4,6-Trifluorophenylboron, IPEIGKHHSZFAEW-UHFFFAOYSA-N, B-(2,4,6-Trifluorophenyl)boronic acid