cas: 135159-25-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,4,6-Trimethoxyphenylboronic acid, 98%, 98% (CAS 135159-25-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114FNK-50mg |
| cas | 135159-25-0 |
| opakowanie | 50mg |
| dostępność | 50g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 98,00 Pln | |
| Chemat | 100mg | 112,40 Pln | |
| Chemat | 250mg | 146,00 Pln | |
| Chemat | 1g | 232,40 Pln | |
| Chemat | 5g | 611,60 Pln | |
| Chemat | 10g | 1130,00 Pln | |
| Chemat | 25g | 2646,80 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2,4,6-trimethoxyphenyl)boronic acid (CAS 135159-25-0) to związek chemiczny o wzorze sumarycznym C9H13BO5 i masie molowej 212.01 g/mol. Nazwa systematyczna IUPAC: (2,4,6-trimethoxyphenyl)boronic acid. InChIKey: PKLRXZVPEQJTTJ-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H13BO5 |
|---|---|
| Masa molowa | 212.01 g/mol |
| Nazwa IUPAC | (2,4,6-trimethoxyphenyl)boronic acid |
| InChIKey | PKLRXZVPEQJTTJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1OC)OC)OC)(O)O |
Dane obliczone przez PubChem (NCBI)