2,5,8,11-Tetraoxatridecan-13-yl methacrylate, 95%
cas: 57454-26-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,5,8,11-Tetraoxatridecan-13-yl methacrylate, 95% (CAS 57454-26-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A2953627-100mg |
| cas | 57454-26-9 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 459,38 Pln | |
| Ambeed | 250mg | 765,31 Pln | |
| Ambeed | 1g | 1950,12 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (CAS 57454-26-9) to związek chemiczny o wzorze sumarycznym C13H24O6 i masie molowej 276.33 g/mol. Nazwa systematyczna IUPAC: 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate. InChIKey: KRCGBOKYIUDIFY-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H24O6 |
|---|---|
| Masa molowa | 276.33 g/mol |
| Nazwa IUPAC | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| InChIKey | KRCGBOKYIUDIFY-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOCCOCCOCCOC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3,6,9,12-Tetraoxatridec-1-yl methacrylate, 2,5,8,11-tetraoxatridecan-13-yl methacrylate, 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate, 3,6,9,12-Tetraoxatridec-1-yl 2-methyl-2-propenoate, tetraethylene glycol monomethyl ether methacrylate, 2-{2-[2-(2-methoxyethoxy)ethoxy]ethoxy}ethyl methacrylate, Poly(ethylene glycol) methyl ether methacrylate, average Mn~300, Poly(ethylene glycol) methyl ether methacrylate, average Mn~950, Poly(oxy-1,2-ethanediyl), alpha-(2-methyl-1-oxo-2-propen-1-yl)-omega-methoxy-