2,5-Difluoro-1,4-phenylenediboronicacid, 95%
cas: 1256358-83-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,5-Difluoro-1,4-phenylenediboronicacid, 95% (CAS 1256358-83-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch111O7I-100mg |
| cas | 1256358-83-4 |
| opakowanie | 100mg |
| dostępność | 50g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 102,80 Pln | |
| Chemat | 250mg | 131,60 Pln | |
| Chemat | 1g | 256,40 Pln | |
| Chemat | 5g | 957,20 Pln | |
| Chemat | 10g | 1739,60 Pln | |
| Chemat | 25g | 3678,80 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
(4-borono-2,5-difluorophenyl)boronic acid (CAS 1256358-83-4) to związek chemiczny o wzorze sumarycznym C6H6B2F2O4 i masie molowej 201.73 g/mol. Nazwa systematyczna IUPAC: (4-borono-2,5-difluorophenyl)boronic acid. InChIKey: CSOLBHLZNAGMMP-UHFFFAOYSA-N.
| Wzór sumaryczny | C6H6B2F2O4 |
|---|---|
| Masa molowa | 201.73 g/mol |
| Nazwa IUPAC | (4-borono-2,5-difluorophenyl)boronic acid |
| InChIKey | CSOLBHLZNAGMMP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)B(O)O)F)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(2,5-Difluoro-1,4-phenylene)diboronic acid, (4-borono-2,5-difluorophenyl)boronic acid, Boronic acid, B,B'-(2,5-difluoro-1,4-phenylene)bis-, (2,5-Difluoro-1,4-phenylene)diboronicacid, [4-(dihydroxyboranyl)-2,5-difluorophenyl]boronic acid, 2,5-Difluoro-1,4-phenylenediboronicacid, (4-borono-2,5-difluoro-phenyl)boronic acid