cas: 7310-97-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,5-Dimethoxyterephthalaldehyde, 97%, 97% (CAS 7310-97-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250g, 500g, 100mg, 250mg, 1g, 5g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114FYW-250g |
| cas | 7310-97-6 |
| opakowanie | 250g |
| dostępność | 500g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250g | 12237,20 Pln | |
| Chemat | 500g | 17179,20 Pln | |
| Chemat | 100mg | 78,80 Pln | |
| Chemat | 250mg | 93,20 Pln | |
| Chemat | 1g | 184,40 Pln | |
| Chemat | 5g | 525,20 Pln | |
| Chemat | 25g | 2354,00 Pln | |
| Chemat | 100g | 7437,20 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
2,5-dimethoxyterephthalaldehyde (CAS 7310-97-6) to związek chemiczny o wzorze sumarycznym C10H10O4 i masie molowej 194.18 g/mol. Nazwa systematyczna IUPAC: 2,5-dimethoxyterephthalaldehyde. InChIKey: YSIIHTHHMPYKFP-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H10O4 |
|---|---|
| Masa molowa | 194.18 g/mol |
| Nazwa IUPAC | 2,5-dimethoxyterephthalaldehyde |
| InChIKey | YSIIHTHHMPYKFP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C=O)OC)C=O |
Dane obliczone przez PubChem (NCBI)