cas: 5451-40-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,6-Dichloropurine, 99.95% (CAS 5451-40-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 g, 250 g, 10 g, 25 g, 1 g, 50 g, 500 g, 100 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-W007367-5 g |
| cas | 5451-40-1 |
| opakowanie | 5 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 g | 361,49 Pln | |
| MedChemExpress | 250 g | 3356,87 Pln | |
| MedChemExpress | 10 g | 477,59 Pln | |
| MedChemExpress | 25 g | 839,82 Pln | |
| MedChemExpress | 1 g | 240,74 Pln | |
| MedChemExpress | 50 g | 1197,41 Pln | |
| MedChemExpress | 500 g | 4963,69 Pln | |
| MedChemExpress | 100 g | 1736,11 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.95% |
2,6-dichloro-7H-purine (CAS 5451-40-1) to związek chemiczny o wzorze sumarycznym C5H2Cl2N4 i masie molowej 189.00 g/mol. Nazwa systematyczna IUPAC: 2,6-dichloro-7H-purine. InChIKey: RMFWVOLULURGJI-UHFFFAOYSA-N.
| Wzór sumaryczny | C5H2Cl2N4 |
|---|---|
| Masa molowa | 189.00 g/mol |
| Nazwa IUPAC | 2,6-dichloro-7H-purine |
| InChIKey | RMFWVOLULURGJI-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)Cl)Cl |
Dane obliczone przez PubChem (NCBI)