2,7-Diiodophenanthrene-9,10-dione, 97%
cas: 16218-32-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,7-Diiodophenanthrene-9,10-dione, 97% (CAS 16218-32-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112SUE-250mg |
| cas | 16218-32-9 |
| opakowanie | 250mg |
| dostępność | 25g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 251,60 Pln | |
| Chemat | 1g | 568,40 Pln | |
| Chemat | 5g | 1830,80 Pln | |
| Fluorochem | 250mg | 305,12 Pln | |
| Fluorochem | 5g | 2372,10 Pln | |
| Fluorochem | 1g | 726,85 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
2,7-diiodophenanthrene-9,10-dione (CAS 16218-32-9) to związek chemiczny o wzorze sumarycznym C14H6I2O2 i masie molowej 460.00 g/mol. Nazwa systematyczna IUPAC: 2,7-diiodophenanthrene-9,10-dione. InChIKey: FJEXTLBWOUQIBN-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H6I2O2 |
|---|---|
| Masa molowa | 460.00 g/mol |
| Nazwa IUPAC | 2,7-diiodophenanthrene-9,10-dione |
| InChIKey | FJEXTLBWOUQIBN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C(=O)C(=O)C3=C2C=CC(=C3)I |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2,7-diiodophenanthrene-9,10-dione, 2,7-Diiodophenanthrenequinone, 9,10-Phenanthrenedione, 2,7-diiodo-, 2,7-Diiodo-phenanthrene-9,10-dione, FJEXTLBWOUQIBN-UHFFFAOYSA-N, Phenanthrenequinone, 2,7-diiodo-, 2,7-diiodo-9,10-phenanthrenequinone, 2,7-Diiodo-9,10-phenanthrenedione #, Phenantrene-9,10(9H,10H)-dione, 2,7-diiodo-, 2,7-Diiodophenanthrenequinone ISO 90012015 REACH