cas: 582-16-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,7-Dimethylnaphthalene, 99.96% (CAS 582-16-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 g, 1 g, 10 g, 100 g, 250 mg, 25 g, 10mM/1mL, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-W045990-5 g |
| cas | 582-16-1 |
| opakowanie | 5 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 g | 1197,41 Pln | |
| MedChemExpress | 1 g | 477,59 Pln | |
| MedChemExpress | 10 g | 1847,57 Pln | |
| MedChemExpress | 100 g | 11395,63 Pln | |
| MedChemExpress | 250 mg | 310,40 Pln | |
| MedChemExpress | 25 g | 3575,14 Pln | |
| MedChemExpress | 10mM/1mL | 250,03 Pln | |
| MedChemExpress | 100 mg | 240,74 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.96% |
2,7-dimethylnaphthalene (CAS 582-16-1) to związek chemiczny o wzorze sumarycznym C12H12 i masie molowej 156.22 g/mol. Nazwa systematyczna IUPAC: 2,7-dimethylnaphthalene. InChIKey: LRQYSMQNJLZKPS-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H12 |
|---|---|
| Masa molowa | 156.22 g/mol |
| Nazwa IUPAC | 2,7-dimethylnaphthalene |
| InChIKey | LRQYSMQNJLZKPS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=CC(=C2)C |
Dane obliczone przez PubChem (NCBI)