2,8-Bis(trifluoromethoxy)-5-(trifluoromethyl)-5H-dibenzo[b,d]thiophen-5-ium trifluoromethanesulfonate, 95%
cas: 2833773-70-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,8-Bis(trifluoromethoxy)-5-(trifluoromethyl)-5H-dibenzo[b,d]thiophen-5-ium trifluoromethanesulfonate, 95% (CAS 2833773-70-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g. Oferty producentów: BLDpharm, Chemat.
| producent | BLDpharm |
|---|---|
| nr katalogowy | BD01605343-250mg |
| cas | 2833773-70-7 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| BLDpharm | 250mg | 608,70 Pln | |
| BLDpharm | 1g | 1724,97 Pln | |
| BLDpharm | 5g | 6562,16 Pln | |
| BLDpharm | 10g | 9000,19 Pln | |
| Chemat | 5g | 3318,80 Pln | |
| Chemat | 10g | 3971,60 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
2,8-bis(trifluoromethoxy)-5-(trifluoromethyl)dibenzothiophen-5-ium;trifluoromethanesulfonate (CAS 2833773-70-7) to związek chemiczny o wzorze sumarycznym C16H6F12O5S2 i masie molowej 570.3 g/mol. Nazwa systematyczna IUPAC: 2,8-bis(trifluoromethoxy)-5-(trifluoromethyl)dibenzothiophen-5-ium;trifluoromethanesulfonate. InChIKey: MBNSTWFNNZPKDH-UHFFFAOYSA-M.
| Wzór sumaryczny | C16H6F12O5S2 |
|---|---|
| Masa molowa | 570.3 g/mol |
| Nazwa IUPAC | 2,8-bis(trifluoromethoxy)-5-(trifluoromethyl)dibenzothiophen-5-ium;trifluoromethanesulfonate |
| InChIKey | MBNSTWFNNZPKDH-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)C3=C([S+]2C(F)(F)F)C=CC(=C3)OC(F)(F)F.C(F)(F)(F)S(=O)(=O)[O-] |
Dane obliczone przez PubChem (NCBI)