2-([1,1'-Biphenyl]-4-yloxy)acetic acid, 97%
cas: 13333-86-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-([1,1'-Biphenyl]-4-yloxy)acetic acid, 97% (CAS 13333-86-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1125NW-100mg |
| cas | 13333-86-3 |
| opakowanie | 100mg |
| dostępność | 25g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 448,40 Pln | |
| Chemat | 250mg | 582,80 Pln | |
| Chemat | 1g | 1787,60 Pln | |
| Chemat | 5g | 2406,80 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
2-(4-phenylphenoxy)acetic acid (CAS 13333-86-3) to związek chemiczny o wzorze sumarycznym C14H12O3 i masie molowej 228.24 g/mol. Nazwa systematyczna IUPAC: 2-(4-phenylphenoxy)acetic acid. InChIKey: UEXMWDXKHUIBSJ-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H12O3 |
|---|---|
| Masa molowa | 228.24 g/mol |
| Nazwa IUPAC | 2-(4-phenylphenoxy)acetic acid |
| InChIKey | UEXMWDXKHUIBSJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)OCC(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-(4-phenylphenoxy)acetic acid, (biphenyl-4-yloxy)acetic acid, 2-([1,1'-biphenyl]-4-yloxy)acetic acid, (Biphenyl-4-yloxy)-acetic acid, (4-biphenylyloxy)acetic acid, (1,1'-biphenyl-4-yloxy)acetic acid, 2-{[1,1'-biphenyl]-4-yloxy}acetic acid, 2-([1,1'-Biphenyl]-4-yloxy)-acetic acid, Acetic acid, 2-([1,1'-biphenyl]-4-yloxy)-, 2-(Biphenyl-4-yloxy)acetic acid