cas: 325141-71-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetonitrile, 98%, 98% (CAS 325141-71-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11C1CI-100mg |
| cas | 325141-71-7 |
| opakowanie | 100mg |
| dostępność | 15g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 93,20 Pln | |
| Chemat | 250mg | 102,80 Pln | |
| Chemat | 1g | 227,60 Pln | |
| Chemat | 5g | 856,40 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile (CAS 325141-71-7) to związek chemiczny o wzorze sumarycznym C14H18BNO2 i masie molowej 243.11 g/mol. Nazwa systematyczna IUPAC: 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile. InChIKey: FIARMBRSPSECPP-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H18BNO2 |
|---|---|
| Masa molowa | 243.11 g/mol |
| Nazwa IUPAC | 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile |
| InChIKey | FIARMBRSPSECPP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CC#N |
Dane obliczone przez PubChem (NCBI)