2-(3-Methoxy-4-(trifluoromethyl)phenyl)acetic acid, 95%
cas: 1214372-96-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-(3-Methoxy-4-(trifluoromethyl)phenyl)acetic acid, 95% (CAS 1214372-96-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 100mg. Oferty producentów: Ambeed, Chemat.
| producent | Ambeed |
|---|---|
| nr katalogowy | A401905-250mg |
| cas | 1214372-96-9 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 325,88 Pln | |
| Ambeed | 1g | 642,94 Pln | |
| Chemat | 100mg | 270,80 Pln | |
| Chemat | 250mg | 371,60 Pln | |
| Chemat | 1g | 837,20 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
2-[3-methoxy-4-(trifluoromethyl)phenyl]acetic acid (CAS 1214372-96-9) to związek chemiczny o wzorze sumarycznym C10H9F3O3 i masie molowej 234.17 g/mol. Nazwa systematyczna IUPAC: 2-[3-methoxy-4-(trifluoromethyl)phenyl]acetic acid. InChIKey: CANSVHIUOSLUFO-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H9F3O3 |
|---|---|
| Masa molowa | 234.17 g/mol |
| Nazwa IUPAC | 2-[3-methoxy-4-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | CANSVHIUOSLUFO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CC(=O)O)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-(3-Methoxy-4-(trifluoromethyl)phenyl)acetic acid, 3-Methoxy-4-(trifluoromethyl)phenylacetic acid, 2-[3-methoxy-4-(trifluoromethyl)phenyl]acetic acid, Benzeneacetic acid, 3-methoxy-4-(trifluoromethyl)-, [3-Methoxy-4-(trifluoromethyl)phenyl]acetic acid, 2-(3-Methoxy-4-(trifluoromethyl)phenyl)aceticacid, 2-[3-methoxy-4-(trifluoromethyl)phenyl]ethanoic acid