2-(4'-(Diphenylamino)-[1,1'-biphenyl]-4-yl)acetonitrile, 98%
cas: 1000504-19-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-(4'-(Diphenylamino)-[1,1'-biphenyl]-4-yl)acetonitrile, 98% (CAS 1000504-19-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Ambeed, BLDpharm, Chemat, Fluorochem.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1359677-100mg |
| cas | 1000504-19-7 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 170,12 Pln | |
| Ambeed | 250mg | 220,19 Pln | |
| Ambeed | 1g | 453,81 Pln | |
| Ambeed | 5g | 1399,44 Pln | |
| BLDpharm | 100mg | 158,86 Pln | |
| BLDpharm | 250mg | 231,05 Pln | |
| BLDpharm | 1g | 486,52 Pln | |
| BLDpharm | 5g | 1502,83 Pln | |
| Chemat | 100mg | 150,80 Pln | |
| Chemat | 250mg | 170,00 Pln | |
| Chemat | 1g | 357,20 Pln | |
| Chemat | 5g | 1096,40 Pln | |
| Fluorochem | 100mg | 247,85 Pln | |
| Fluorochem | 250mg | 294,71 Pln | |
| Fluorochem | 1g | 643,54 Pln | |
| Fluorochem | 5g | 2028,47 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
2-[4-[4-(N-phenylanilino)phenyl]phenyl]acetonitrile (CAS 1000504-19-7) to związek chemiczny o wzorze sumarycznym C26H20N2 i masie molowej 360.4 g/mol. Nazwa systematyczna IUPAC: 2-[4-[4-(N-phenylanilino)phenyl]phenyl]acetonitrile. InChIKey: KZXLEMCJJXTCCC-UHFFFAOYSA-N.
| Wzór sumaryczny | C26H20N2 |
|---|---|
| Masa molowa | 360.4 g/mol |
| Nazwa IUPAC | 2-[4-[4-(N-phenylanilino)phenyl]phenyl]acetonitrile |
| InChIKey | KZXLEMCJJXTCCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)CC#N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-(4'-(Diphenylamino)-[1,1'-biphenyl]-4-yl)acetonitrile, 2-[4-[4-(N-phenylanilino)phenyl]phenyl]acetonitrile, 2-[4'-(diphenylamino)-[1,1'-biphenyl]-4-yl]acetonitrile, 4-acetonitrile-4'-diphenylamino) biphenyl, (4-acetonitrile-4'-diphenylamino) biphenyl, [1,1'-Biphenyl]-4-acetonitrile, 4'-(diphenylamino)-, 2-(4''-(Diphenylamino)-[1,1''-biphenyl]-4-yl)acetonitrile, 4,4 inverted exclamation mark -(9,10-Anthracenediyl)Bis[Benzenamine]