2-(4-Amino-3-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 98%
cas: 1992-09-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-(4-Amino-3-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 98% (CAS 1992-09-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 100mg. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A130078-250mg |
| cas | 1992-09-2 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 498,31 Pln | |
| Ambeed | 1g | 1321,56 Pln | |
| BLDpharm | 100mg | 331,02 Pln | |
| BLDpharm | 250mg | 530,95 Pln | |
| BLDpharm | 1g | 1413,97 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
2-(4-amino-3-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 1992-09-2) to związek chemiczny o wzorze sumarycznym C10H9F6NO i masie molowej 273.17 g/mol. Nazwa systematyczna IUPAC: 2-(4-amino-3-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: BBKBZCHWYBHANQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H9F6NO |
|---|---|
| Masa molowa | 273.17 g/mol |
| Nazwa IUPAC | 2-(4-amino-3-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | BBKBZCHWYBHANQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C(F)(F)F)(C(F)(F)F)O)N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-(4-amino-3-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 2-(4-Amino-3-methylphenyl)-1,1,1,3,3,3-hexafluoro-2-propanol, 4-Amino-3-methyl-alpha,alpha-bis(trifluoromethyl)benzyl Alcohol, Benzenemethanol, 4-amino-3-methyl-alpha,alpha-bis(trifluoromethyl)-, 2-(4-Amino-3-methyl-phenyl)-1,1,1,3,3,3-hexafluoro-propan-2-ol, Benzenemethanol, 4-amino-3-methyl-|A,|A-bis(trifluoromethyl)-, 2-(4-Amino-3-methyl-phenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, Benzenemethanol, 2-amino-3-methyl-.alpha.,.alpha.-bis(trifluoromethyl)-
