cas: 1071929-08-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-(5-Iodo-2-methylbenzoyl)-5-(4-fluorophenyl)thiophene, 99.78% (CAS 1071929-08-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 g, 25 g, 5 g, 250 mg, 500 mg, 1 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-I0207-10 g |
| cas | 1071929-08-2 |
| opakowanie | 10 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 g | 983,78 Pln | |
| MedChemExpress | 25 g | 1657,16 Pln | |
| MedChemExpress | 5 g | 672,64 Pln | |
| MedChemExpress | 250 mg | 240,74 Pln | |
| MedChemExpress | 500 mg | 287,18 Pln | |
| MedChemExpress | 1 g | 361,49 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.78% |
[5-(4-fluorophenyl)thiophen-2-yl]-(5-iodo-2-methylphenyl)methanone (CAS 1071929-08-2) to związek chemiczny o wzorze sumarycznym C18H12FIOS i masie molowej 422.3 g/mol. Nazwa systematyczna IUPAC: [5-(4-fluorophenyl)thiophen-2-yl]-(5-iodo-2-methylphenyl)methanone. InChIKey: UCEUYWYTFYVWBY-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H12FIOS |
|---|---|
| Masa molowa | 422.3 g/mol |
| Nazwa IUPAC | [5-(4-fluorophenyl)thiophen-2-yl]-(5-iodo-2-methylphenyl)methanone |
| InChIKey | UCEUYWYTFYVWBY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)I)C(=O)C2=CC=C(S2)C3=CC=C(C=C3)F |
Dane obliczone przez PubChem (NCBI)