2-(6-Methoxynaphthalen-2-yl)acetic acid, 97%, 97%
cas: 23981-47-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2-(6-Methoxynaphthalen-2-yl)acetic acid, 97%, 97% (CAS 23981-47-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10g, 100mg, 250mg, 500mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11BDTH-10g |
| cas | 23981-47-7 |
| opakowanie | 10g |
| dostępność | 16g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 10g | 990,80 Pln | |
| Chemat | 100mg | 83,60 Pln | |
| Chemat | 250mg | 102,80 Pln | |
| Chemat | 500mg | 136,40 Pln | |
| Chemat | 1g | 198,80 Pln | |
| Chemat | 5g | 611,60 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
2-(6-methoxynaphthalen-2-yl)acetic acid (CAS 23981-47-7) to związek chemiczny o wzorze sumarycznym C13H12O3 i masie molowej 216.23 g/mol. Nazwa systematyczna IUPAC: 2-(6-methoxynaphthalen-2-yl)acetic acid. InChIKey: PHJFLPMVEFKEPL-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H12O3 |
|---|---|
| Masa molowa | 216.23 g/mol |
| Nazwa IUPAC | 2-(6-methoxynaphthalen-2-yl)acetic acid |
| InChIKey | PHJFLPMVEFKEPL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)CC(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
6-Methoxy-2-naphthylacetic acid, 6-Methoxy-2-naphthaleneacetic acid, (6-methoxy-2-naphthyl)acetic acid, (6-methoxynaphthalen-2-yl)acetic acid, 6-MNA cpd, 2-(6-methoxynaphthalen-2-yl)acetic acid, Naproxen EP Impurity I, 6-Methoxynaphthalene-2-acetic acid, 2-(6-methoxy-2-naphthyl)acetic acid, Desmethyl naproxen